C12H15ClN2O — CID 170254370
2-chloro-5,5,8,8-tetramethyl-6H-1,6-naphthyridin-7-one (PubChem CID 170254370) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 2-chloro-5,5,8,8-tetramethyl-6H-1,6-naphthyridin-7-one.
| Compound Name | 2-chloro-5,5,8,8-tetramethyl-6H-1,6-naphthyridin-7-one |
|---|---|
| PubChem CID | 170254370 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-chloro-5,5,8,8-tetramethyl-6H-1,6-naphthyridin-7-one |
| SMILES | CC1(C)NC(=O)C(C)(C)c2nc(Cl)ccc21 |
| InChI | InChI=1S/C12H15ClN2O/c1-11(2)9-7(5-6-8(13)14-9)12(3,4)15-10(11)16/h5-6H,1-4H3,(H,15,16) |
| InChIKey | DVNBNCYGHNKIBC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|