C13H16ClN3O — CID 113316813
6-chloro-4'-methylspiro[1,4-dihydropyrido[2,3-b]pyrazine-3,1'-cyclohexane]-2-one (PubChem CID 113316813) has the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. Its IUPAC name is 6-chloro-4'-methylspiro[1,4-dihydropyrido[2,3-b]pyrazine-3,1'-cyclohexane]-2-one.
| Compound Name | 6-chloro-4'-methylspiro[1,4-dihydropyrido[2,3-b]pyrazine-3,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 113316813 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 6-chloro-4'-methylspiro[1,4-dihydropyrido[2,3-b]pyrazine-3,1'-cyclohexane]-2-one |
| SMILES | CC1CCC2(CC1)Nc1nc(Cl)ccc1NC2=O |
| InChI | InChI=1S/C13H16ClN3O/c1-8-4-6-13(7-5-8)12(18)15-9-2-3-10(14)16-11(9)17-13/h2-3,8H,4-7H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | ZRMIYHOZPLAWEV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|