C10H10ClN3O — CID 115473868
6-chloro-3-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one (PubChem CID 115473868) has the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. Its IUPAC name is 6-chloro-3-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 6-chloro-3-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 115473868 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 6-chloro-3-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b]pyrazin-2-one |
| SMILES | O=C1Nc2ccc(Cl)nc2NC1C1CC1 |
| InChI | InChI=1S/C10H10ClN3O/c11-7-4-3-6-9(13-7)14-8(5-1-2-5)10(15)12-6/h3-5,8H,1-2H2,(H,12,15)(H,13,14) |
| InChIKey | IDIRYBZWCWVLKZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|