C8H10ClN3 — CID 145087238
7-chloro-2,3,4,5-tetrahydro-1H-pyrido[2,3-b][1,4]diazepine (PubChem CID 145087238) has the molecular formula C8H10ClN3 and a molecular weight of 183.64 g/mol. Its IUPAC name is 7-chloro-2,3,4,5-tetrahydro-1H-pyrido[2,3-b][1,4]diazepine.
| Compound Name | 7-chloro-2,3,4,5-tetrahydro-1H-pyrido[2,3-b][1,4]diazepine |
|---|---|
| PubChem CID | 145087238 |
| Molecular Formula | C8H10ClN3 |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | 7-chloro-2,3,4,5-tetrahydro-1H-pyrido[2,3-b][1,4]diazepine |
| SMILES | Clc1ccc2c(n1)NCCCN2 |
| InChI | InChI=1S/C8H10ClN3/c9-7-3-2-6-8(12-7)11-5-1-4-10-6/h2-3,10H,1,4-5H2,(H,11,12) |
| InChIKey | QKYAPGOKLNNUBE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|