C9H14ClN3O — CID 144746653
6-chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine;ethanol (PubChem CID 144746653) has the molecular formula C9H14ClN3O and a molecular weight of 215.68 g/mol. Its IUPAC name is 6-chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine;ethanol.
| Compound Name | 6-chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine;ethanol |
|---|---|
| PubChem CID | 144746653 |
| Molecular Formula | C9H14ClN3O |
| Molecular Weight | 215.68 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 6-chloro-1,2,3,4-tetrahydropyrido[2,3-b]pyrazine;ethanol |
| SMILES | CCO.Clc1ccc2c(n1)NCCN2 |
| InChI | InChI=1S/C7H8ClN3.C2H6O/c8-6-2-1-5-7(11-6)10-4-3-9-5;1-2-3/h1-2,9H,3-4H2,(H,10,11);3H,2H2,1H3 |
| InChIKey | MXTIXNYSJVGSHV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.68 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|