C9H10ClN3O — CID 19932785
6-chloro-3,3-dimethyl-1,4-dihydropyrido[2,3-b]pyrazin-2-one (PubChem CID 19932785) has the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. Its IUPAC name is 6-chloro-3,3-dimethyl-1,4-dihydropyrido[2,3-b]pyrazin-2-one.
| Compound Name | 6-chloro-3,3-dimethyl-1,4-dihydropyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 19932785 |
| Molecular Formula | C9H10ClN3O |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 6-chloro-3,3-dimethyl-1,4-dihydropyrido[2,3-b]pyrazin-2-one |
| SMILES | CC1(C)Nc2nc(Cl)ccc2NC1=O |
| InChI | InChI=1S/C9H10ClN3O/c1-9(2)8(14)11-5-3-4-6(10)12-7(5)13-9/h3-4H,1-2H3,(H,11,14)(H,12,13) |
| InChIKey | QGKJGXNQBAUDAQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|