C10H11ClN2O3S — CID 84713969
3,3-dimethyl-2-oxo-1,4-dihydroquinoxaline-6-sulfonyl chloride (PubChem CID 84713969) has the molecular formula C10H11ClN2O3S and a molecular weight of 274.73 g/mol. Its IUPAC name is 3,3-dimethyl-2-oxo-1,4-dihydroquinoxaline-6-sulfonyl chloride.
| Compound Name | 3,3-dimethyl-2-oxo-1,4-dihydroquinoxaline-6-sulfonyl chloride |
|---|---|
| PubChem CID | 84713969 |
| Molecular Formula | C10H11ClN2O3S |
| Molecular Weight | 274.73 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 3,3-dimethyl-2-oxo-1,4-dihydroquinoxaline-6-sulfonyl chloride |
| SMILES | CC1(C)Nc2cc(S(=O)(=O)Cl)ccc2NC1=O |
| InChI | InChI=1S/C10H11ClN2O3S/c1-10(2)9(14)12-7-4-3-6(17(11,15)16)5-8(7)13-10/h3-5,13H,1-2H3,(H,12,14) |
| InChIKey | QNKGOEBKIXCILC-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.73 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |