C8H7ClN2O2S — CID 19958575
1,4-dihydroquinoxaline-6-sulfonyl chloride (PubChem CID 19958575) has the molecular formula C8H7ClN2O2S and a molecular weight of 230.68 g/mol. Its IUPAC name is 1,4-dihydroquinoxaline-6-sulfonyl chloride.
| Compound Name | 1,4-dihydroquinoxaline-6-sulfonyl chloride |
|---|---|
| PubChem CID | 19958575 |
| Molecular Formula | C8H7ClN2O2S |
| Molecular Weight | 230.68 g/mol |
| Exact Mass | 229.99 |
| IUPAC Name | 1,4-dihydroquinoxaline-6-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc2c(c1)NC=CN2 |
| InChI | InChI=1S/C8H7ClN2O2S/c9-14(12,13)6-1-2-7-8(5-6)11-4-3-10-7/h1-5,10-11H |
| InChIKey | ZQFNIOYWWMQEBT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |