C8H8ClNO2S2 — CID 141356128
3,4-dihydro-2H-1,4-benzothiazine-7-sulfonyl chloride (PubChem CID 141356128) has the molecular formula C8H8ClNO2S2 and a molecular weight of 249.74 g/mol. Its IUPAC name is 3,4-dihydro-2H-1,4-benzothiazine-7-sulfonyl chloride.
| Compound Name | 3,4-dihydro-2H-1,4-benzothiazine-7-sulfonyl chloride |
|---|---|
| PubChem CID | 141356128 |
| Molecular Formula | C8H8ClNO2S2 |
| Molecular Weight | 249.74 g/mol |
| Exact Mass | 248.97 |
| IUPAC Name | 3,4-dihydro-2H-1,4-benzothiazine-7-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc2c(c1)SCCN2 |
| InChI | InChI=1S/C8H8ClNO2S2/c9-14(11,12)6-1-2-7-8(5-6)13-4-3-10-7/h1-2,5,10H,3-4H2 |
| InChIKey | OOPMSUJSGMJEHV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.74 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |