C12H18N2O — CID 90978779
3,3-dimethyl-1,4-dihydroquinoxalin-2-one;ethane (PubChem CID 90978779) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 3,3-dimethyl-1,4-dihydroquinoxalin-2-one;ethane.
| Compound Name | 3,3-dimethyl-1,4-dihydroquinoxalin-2-one;ethane |
|---|---|
| PubChem CID | 90978779 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 3,3-dimethyl-1,4-dihydroquinoxalin-2-one;ethane |
| SMILES | CC.CC1(C)Nc2ccccc2NC1=O |
| InChI | InChI=1S/C10H12N2O.C2H6/c1-10(2)9(13)11-7-5-3-4-6-8(7)12-10;1-2/h3-6,12H,1-2H3,(H,11,13);1-2H3 |
| InChIKey | XSMFCQNMVXPELS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |