C11H12N2O3 — CID 112577462
3,3-dimethyl-2-oxo-1,4-dihydroquinoxaline-5-carboxylic acid (PubChem CID 112577462) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3,3-dimethyl-2-oxo-1,4-dihydroquinoxaline-5-carboxylic acid.
| Compound Name | 3,3-dimethyl-2-oxo-1,4-dihydroquinoxaline-5-carboxylic acid |
|---|---|
| PubChem CID | 112577462 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3,3-dimethyl-2-oxo-1,4-dihydroquinoxaline-5-carboxylic acid |
| SMILES | CC1(C)Nc2c(cccc2C(=O)O)NC1=O |
| InChI | InChI=1S/C11H12N2O3/c1-11(2)10(16)12-7-5-3-4-6(9(14)15)8(7)13-11/h3-5,13H,1-2H3,(H,12,16)(H,14,15) |
| InChIKey | PMZCJSLQTPEVJW-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |