C12H16N2O — CID 84620322
5-ethyl-3,3-dimethyl-1,4-dihydroquinoxalin-2-one (PubChem CID 84620322) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 5-ethyl-3,3-dimethyl-1,4-dihydroquinoxalin-2-one.
| Compound Name | 5-ethyl-3,3-dimethyl-1,4-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 84620322 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 5-ethyl-3,3-dimethyl-1,4-dihydroquinoxalin-2-one |
| SMILES | CCc1cccc2c1NC(C)(C)C(=O)N2 |
| InChI | InChI=1S/C12H16N2O/c1-4-8-6-5-7-9-10(8)14-12(2,3)11(15)13-9/h5-7,14H,4H2,1-3H3,(H,13,15) |
| InChIKey | WEWBEIQPBVQIFV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |