C12H13NO4 — CID 84628063
2-(7-ethyl-3-hydroxy-2-oxo-1H-indol-3-yl)acetic acid (PubChem CID 84628063) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is 2-(7-ethyl-3-hydroxy-2-oxo-1H-indol-3-yl)acetic acid.
| Compound Name | 2-(7-ethyl-3-hydroxy-2-oxo-1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 84628063 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2-(7-ethyl-3-hydroxy-2-oxo-1H-indol-3-yl)acetic acid |
| SMILES | CCc1cccc2c1NC(=O)C2(O)CC(=O)O |
| InChI | InChI=1S/C12H13NO4/c1-2-7-4-3-5-8-10(7)13-11(16)12(8,17)6-9(14)15/h3-5,17H,2,6H2,1H3,(H,13,16)(H,14,15) |
| InChIKey | WZQNADOUKRYSGT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |