C11H14N2OS — CID 115096446
8-(aminomethyl)-2,2-dimethyl-4H-1,4-benzothiazin-3-one (PubChem CID 115096446) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 8-(aminomethyl)-2,2-dimethyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 8-(aminomethyl)-2,2-dimethyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115096446 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 8-(aminomethyl)-2,2-dimethyl-4H-1,4-benzothiazin-3-one |
| SMILES | CC1(C)Sc2c(CN)cccc2NC1=O |
| InChI | InChI=1S/C11H14N2OS/c1-11(2)10(14)13-8-5-3-4-7(6-12)9(8)15-11/h3-5H,6,12H2,1-2H3,(H,13,14) |
| InChIKey | OKZVRQSNLVIHFF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |