C12H15NOS — CID 84623973
2,2,6,7-tetramethyl-4H-1,4-benzothiazin-3-one (PubChem CID 84623973) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 2,2,6,7-tetramethyl-4H-1,4-benzothiazin-3-one.
| Compound Name | 2,2,6,7-tetramethyl-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84623973 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2,2,6,7-tetramethyl-4H-1,4-benzothiazin-3-one |
| SMILES | Cc1cc2c(cc1C)SC(C)(C)C(=O)N2 |
| InChI | InChI=1S/C12H15NOS/c1-7-5-9-10(6-8(7)2)15-12(3,4)11(14)13-9/h5-6H,1-4H3,(H,13,14) |
| InChIKey | FQTBTIXAJNERTI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |