C11H14N2O2 — CID 115095893
3,3-dimethyl-2,4-dihydro-1H-quinoxaline-5-carboxylic acid (PubChem CID 115095893) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dihydro-1H-quinoxaline-5-carboxylic acid.
| Compound Name | 3,3-dimethyl-2,4-dihydro-1H-quinoxaline-5-carboxylic acid |
|---|---|
| PubChem CID | 115095893 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 3,3-dimethyl-2,4-dihydro-1H-quinoxaline-5-carboxylic acid |
| SMILES | CC1(C)CNc2cccc(C(=O)O)c2N1 |
| InChI | InChI=1S/C11H14N2O2/c1-11(2)6-12-8-5-3-4-7(10(14)15)9(8)13-11/h3-5,12-13H,6H2,1-2H3,(H,14,15) |
| InChIKey | ZCKBABKBURZRIK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |