About spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid
spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid (PubChem CID 139410820) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid.
Analyze spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid?
The IUPAC name of spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid (CID 139410820) is spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid.
What is the SMILES notation for spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid?
The canonical SMILES for spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid is O=C(O)c1cccc2c1C1(CCC1)CN2.
What is the InChIKey of spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid?
The InChIKey is XEMLTZUJFUGZKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c14-11(15)8-3-1-4-9-10(8)12(7-13-9)5-2-6-12/h1,3-4,13H,2,5-7H2,(H,14,15).
What are the key properties of spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid?
spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid has a molecular weight of 203.24 g/mol, XLogP of 2.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,2-dihydroindole-3,1'-cyclobutane]-4-carboxylic acid is sourced from PubChem (CID 139410820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).