C17H25N5O4+2 — CID 89306241
4,4,7,10,10-pentamethyl-6-oxo-2,9,12-triaza-4,6-diazoniabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3,8,11-trione (PubChem CID 89306241) has the molecular formula C17H25N5O4+2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4,4,7,10,10-pentamethyl-6-oxo-2,9,12-triaza-4,6-diazoniabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3,8,11-trione.
| Compound Name | 4,4,7,10,10-pentamethyl-6-oxo-2,9,12-triaza-4,6-diazoniabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3,8,11-trione |
|---|---|
| PubChem CID | 89306241 |
| Molecular Formula | C17H25N5O4+2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 4,4,7,10,10-pentamethyl-6-oxo-2,9,12-triaza-4,6-diazoniabicyclo[11.4.0]heptadeca-1(17),13,15-triene-3,8,11-trione |
| SMILES | CC1C(=O)NC(C)(C)C(=O)Nc2ccccc2NC(=O)[N+](C)(C)C[N+]1=O |
| InChI | InChI=1S/C17H23N5O4/c1-11-14(23)20-17(2,3)15(24)18-12-8-6-7-9-13(12)19-16(25)22(4,5)10-21(11)26/h6-9,11H,10H2,1-5H3,(H-2,18,19,20,23,24,25)/p+2 |
| InChIKey | CITZBZHCMPIELA-UHFFFAOYSA-P |
| XLogP | 1.27 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|