C10H11NOS — CID 115094877
3,3-dimethyl-4H-1,4-benzothiazin-2-one (PubChem CID 115094877) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 3,3-dimethyl-4H-1,4-benzothiazin-2-one.
| Compound Name | 3,3-dimethyl-4H-1,4-benzothiazin-2-one |
|---|---|
| PubChem CID | 115094877 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 3,3-dimethyl-4H-1,4-benzothiazin-2-one |
| SMILES | CC1(C)Nc2ccccc2SC1=O |
| InChI | InChI=1S/C10H11NOS/c1-10(2)9(12)13-8-6-4-3-5-7(8)11-10/h3-6,11H,1-2H3 |
| InChIKey | QPAOJYLCGYBPOD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|