C9H10Cl2N2 — CID 79014766
7,8-dichloro-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine (PubChem CID 79014766) has the molecular formula C9H10Cl2N2 and a molecular weight of 217.10 g/mol. Its IUPAC name is 7,8-dichloro-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine.
| Compound Name | 7,8-dichloro-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 79014766 |
| Molecular Formula | C9H10Cl2N2 |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 7,8-dichloro-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
| SMILES | Clc1cc2c(cc1Cl)NCCCN2 |
| InChI | InChI=1S/C9H10Cl2N2/c10-6-4-8-9(5-7(6)11)13-3-1-2-12-8/h4-5,12-13H,1-3H2 |
| InChIKey | KGWWAHMBISOKQC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |