C11H12ClN3O — CID 115473848
7-chloro-5-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b][1,4]diazepin-2-one (PubChem CID 115473848) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 7-chloro-5-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b][1,4]diazepin-2-one.
| Compound Name | 7-chloro-5-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 115473848 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 7-chloro-5-cyclopropyl-3,4-dihydro-1H-pyrido[2,3-b][1,4]diazepin-2-one |
| SMILES | O=C1CCN(C2CC2)c2nc(Cl)ccc2N1 |
| InChI | InChI=1S/C11H12ClN3O/c12-9-4-3-8-11(14-9)15(7-1-2-7)6-5-10(16)13-8/h3-4,7H,1-2,5-6H2,(H,13,16) |
| InChIKey | WTJKQCXESVPLSF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|