C20H22ClN7O — CID 129237808
(3R)-3-(azidomethyl)-4-(1-benzylpiperidin-4-yl)-6-chloro-1,3-dihydropyrido[2,3-b]pyrazin-2-one (PubChem CID 129237808) has the molecular formula C20H22ClN7O and a molecular weight of 411.90 g/mol. Its IUPAC name is (3R)-3-(azidomethyl)-4-(1-benzylpiperidin-4-yl)-6-chloro-1,3-dihydropyrido[2,3-b]pyrazin-2-one.
| Compound Name | (3R)-3-(azidomethyl)-4-(1-benzylpiperidin-4-yl)-6-chloro-1,3-dihydropyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 129237808 |
| Molecular Formula | C20H22ClN7O |
| Molecular Weight | 411.90 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (3R)-3-(azidomethyl)-4-(1-benzylpiperidin-4-yl)-6-chloro-1,3-dihydropyrido[2,3-b]pyrazin-2-one |
| SMILES | [N-]=[N+]=NC[C@@H]1C(=O)Nc2ccc(Cl)nc2N1C1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H22ClN7O/c21-18-7-6-16-19(25-18)28(17(12-23-26-22)20(29)24-16)15-8-10-27(11-9-15)13-14-4-2-1-3-5-14/h1-7,15,17H,8-13H2,(H,24,29)/t17-/m1/s1 |
| InChIKey | WOSYGXRLMCVTEX-QGZVFWFLSA-N |
| XLogP | 3.84 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.90 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|