C9H7ClN2O3S — CID 13397039
2-(6-chloro-2-oxo-1H-pyrido[2,3-b][1,4]thiazin-3-yl)acetic acid (PubChem CID 13397039) has the molecular formula C9H7ClN2O3S and a molecular weight of 258.69 g/mol. Its IUPAC name is 2-(6-chloro-2-oxo-1H-pyrido[2,3-b][1,4]thiazin-3-yl)acetic acid.
| Compound Name | 2-(6-chloro-2-oxo-1H-pyrido[2,3-b][1,4]thiazin-3-yl)acetic acid |
|---|---|
| PubChem CID | 13397039 |
| Molecular Formula | C9H7ClN2O3S |
| Molecular Weight | 258.69 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 2-(6-chloro-2-oxo-1H-pyrido[2,3-b][1,4]thiazin-3-yl)acetic acid |
| SMILES | O=C(O)CC1Sc2nc(Cl)ccc2NC1=O |
| InChI | InChI=1S/C9H7ClN2O3S/c10-6-2-1-4-9(12-6)16-5(3-7(13)14)8(15)11-4/h1-2,5H,3H2,(H,11,15)(H,13,14) |
| InChIKey | JSZIHUPDZLVIDA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.69 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|