C5H5NO3S2 — CID 51385264
2-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 51385264) has the molecular formula C5H5NO3S2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 51385264 |
| Molecular Formula | C5H5NO3S2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 190.97 |
| IUPAC Name | 2-[(5S)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1SC(=S)NC1=O |
| InChI | InChI=1S/C5H5NO3S2/c7-3(8)1-2-4(9)6-5(10)11-2/h2H,1H2,(H,7,8)(H,6,9,10)/t2-/m0/s1 |
| InChIKey | FUQYIQWKYXNCDI-REOHCLBHSA-N |
| XLogP | -0.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|