C12H10ClN3O3S — CID 670949
2-[(6S)-2-[(4-chlorophenyl)methylideneamino]-5-oxo-4H-1,3,4-thiadiazin-6-yl]acetic acid (PubChem CID 670949) has the molecular formula C12H10ClN3O3S and a molecular weight of 311.75 g/mol. Its IUPAC name is 2-[(6S)-2-[(4-chlorophenyl)methylideneamino]-5-oxo-4H-1,3,4-thiadiazin-6-yl]acetic acid.
| Compound Name | 2-[(6S)-2-[(4-chlorophenyl)methylideneamino]-5-oxo-4H-1,3,4-thiadiazin-6-yl]acetic acid |
|---|---|
| PubChem CID | 670949 |
| Molecular Formula | C12H10ClN3O3S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-[(6S)-2-[(4-chlorophenyl)methylideneamino]-5-oxo-4H-1,3,4-thiadiazin-6-yl]acetic acid |
| SMILES | O=C(O)C[C@@H]1SC(N=Cc2ccc(Cl)cc2)=NNC1=O |
| InChI | InChI=1S/C12H10ClN3O3S/c13-8-3-1-7(2-4-8)6-14-12-16-15-11(19)9(20-12)5-10(17)18/h1-4,6,9H,5H2,(H,15,19)(H,17,18)/t9-/m0/s1 |
| InChIKey | RDVQFSSCCOYZOC-VIFPVBQESA-N |
| XLogP | 1.74 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|