C9H10ClNO — CID 155193886
2-chloro-7-methyl-5,6-dihydrocyclopenta[b]pyridin-7-ol (PubChem CID 155193886) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is 2-chloro-7-methyl-5,6-dihydrocyclopenta[b]pyridin-7-ol.
| Compound Name | 2-chloro-7-methyl-5,6-dihydrocyclopenta[b]pyridin-7-ol |
|---|---|
| PubChem CID | 155193886 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 2-chloro-7-methyl-5,6-dihydrocyclopenta[b]pyridin-7-ol |
| SMILES | CC1(O)CCc2ccc(Cl)nc21 |
| InChI | InChI=1S/C9H10ClNO/c1-9(12)5-4-6-2-3-7(10)11-8(6)9/h2-3,12H,4-5H2,1H3 |
| InChIKey | ALXGNSSTEZJPKW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|