C19H20Cl2N2O2 — CID 161343295
2-chloro-6,7-dihydro-5H-quinolin-8-one;2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol (PubChem CID 161343295) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is 2-chloro-6,7-dihydro-5H-quinolin-8-one;2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol.
| Compound Name | 2-chloro-6,7-dihydro-5H-quinolin-8-one;2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol |
|---|---|
| PubChem CID | 161343295 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 2-chloro-6,7-dihydro-5H-quinolin-8-one;2-chloro-8-methyl-6,7-dihydro-5H-quinolin-8-ol |
| SMILES | CC1(O)CCCc2ccc(Cl)nc21.O=C1CCCc2ccc(Cl)nc21 |
| InChI | InChI=1S/C10H12ClNO.C9H8ClNO/c1-10(13)6-2-3-7-4-5-8(11)12-9(7)10;10-8-5-4-6-2-1-3-7(12)9(6)11-8/h4-5,13H,2-3,6H2,1H3;4-5H,1-3H2 |
| InChIKey | VMYPSQLVOYMCJJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|