C11H12ClNO — CID 91617307
2-chloro-3-ethyl-6,7-dihydro-5H-quinolin-8-one (PubChem CID 91617307) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-chloro-3-ethyl-6,7-dihydro-5H-quinolin-8-one.
| Compound Name | 2-chloro-3-ethyl-6,7-dihydro-5H-quinolin-8-one |
|---|---|
| PubChem CID | 91617307 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-chloro-3-ethyl-6,7-dihydro-5H-quinolin-8-one |
| SMILES | CCc1cc2c(nc1Cl)C(=O)CCC2 |
| InChI | InChI=1S/C11H12ClNO/c1-2-7-6-8-4-3-5-9(14)10(8)13-11(7)12/h6H,2-5H2,1H3 |
| InChIKey | GJVKVUUVFOJBRL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|