C20H32N6O3Si — CID 175555145
[(1S)-3-[3-[(3-methylpyridazin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl] carbamate (PubChem CID 175555145) has the molecular formula C20H32N6O3Si and a molecular weight of 432.60 g/mol. Its IUPAC name is [(1S)-3-[3-[(3-methylpyridazin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl] carbamate.
| Compound Name | [(1S)-3-[3-[(3-methylpyridazin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl] carbamate |
|---|---|
| PubChem CID | 175555145 |
| Molecular Formula | C20H32N6O3Si |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [(1S)-3-[3-[(3-methylpyridazin-4-yl)amino]-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl] carbamate |
| SMILES | Cc1nnccc1Nc1cc(C2CC[C@H](OC(N)=O)C2)n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C20H32N6O3Si/c1-14-17(7-8-22-24-14)23-19-12-18(15-5-6-16(11-15)29-20(21)27)26(25-19)13-28-9-10-30(2,3)4/h7-8,12,15-16H,5-6,9-11,13H2,1-4H3,(H2,21,27)(H,22,23,25)/t15?,16-/m0/s1 |
| InChIKey | NYQDQAHAEVNLGM-LYKKTTPLSA-N |
| XLogP | 3.77 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|