C15H21N7O2 — CID 175185632
[4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl] carbamate (PubChem CID 175185632) has the molecular formula C15H21N7O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is [4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl] carbamate.
| Compound Name | [4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl] carbamate |
|---|---|
| PubChem CID | 175185632 |
| Molecular Formula | C15H21N7O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | [4-[[4-[(5-methyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl] carbamate |
| SMILES | Cc1cc(Nc2ccnc(NC3CCC(OC(N)=O)CC3)n2)n[nH]1 |
| InChI | InChI=1S/C15H21N7O2/c1-9-8-13(22-21-9)19-12-6-7-17-15(20-12)18-10-2-4-11(5-3-10)24-14(16)23/h6-8,10-11H,2-5H2,1H3,(H2,16,23)(H3,17,18,19,20,21,22) |
| InChIKey | GSBLDYWWDOTUTI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |