C19H27N7O2 — CID 175176525
[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl] carbamate (PubChem CID 175176525) has the molecular formula C19H27N7O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is [4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl] carbamate.
| Compound Name | [4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl] carbamate |
|---|---|
| PubChem CID | 175176525 |
| Molecular Formula | C19H27N7O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | [4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl] carbamate |
| SMILES | NC(=O)OC1CCC(Nc2nccc(Nc3cc(C4CCCC4)[nH]n3)n2)CC1 |
| InChI | InChI=1S/C19H27N7O2/c20-18(27)28-14-7-5-13(6-8-14)22-19-21-10-9-16(24-19)23-17-11-15(25-26-17)12-3-1-2-4-12/h9-14H,1-8H2,(H2,20,27)(H3,21,22,23,24,25,26) |
| InChIKey | GFOBDIASERUFDY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 130.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |