C22H34N8O2 — CID 162490781
1-[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl]-3-(2-methoxyethyl)urea (PubChem CID 162490781) has the molecular formula C22H34N8O2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 1-[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 162490781 |
| Molecular Formula | C22H34N8O2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 1-[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]cyclohexyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)NC1CCC(Nc2nccc(Nc3cc(C4CCCC4)[nH]n3)n2)CC1 |
| InChI | InChI=1S/C22H34N8O2/c1-32-13-12-24-22(31)26-17-8-6-16(7-9-17)25-21-23-11-10-19(28-21)27-20-14-18(29-30-20)15-4-2-3-5-15/h10-11,14-17H,2-9,12-13H2,1H3,(H2,24,26,31)(H3,23,25,27,28,29,30) |
| InChIKey | LLKQGDWJLQGHFZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|