C27H33F3N8O — CID 166866982
1-[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]-1-methylcyclohexyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 166866982) has the molecular formula C27H33F3N8O and a molecular weight of 542.61 g/mol. Its IUPAC name is 1-[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]-1-methylcyclohexyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]-1-methylcyclohexyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 166866982 |
| Molecular Formula | C27H33F3N8O |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | 1-[4-[[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]amino]-1-methylcyclohexyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CC1(NC(=O)Nc2cccc(C(F)(F)F)c2)CCC(Nc2nccc(Nc3cc(C4CCCC4)[nH]n3)n2)CC1 |
| InChI | InChI=1S/C27H33F3N8O/c1-26(36-25(39)33-20-8-4-7-18(15-20)27(28,29)30)12-9-19(10-13-26)32-24-31-14-11-22(35-24)34-23-16-21(37-38-23)17-5-2-3-6-17/h4,7-8,11,14-17,19H,2-3,5-6,9-10,12-13H2,1H3,(H2,33,36,39)(H3,31,32,34,35,37,38) |
| InChIKey | YHWZCDNVTZCJBB-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |