C30H37F3N9O+ — CID 154687248
cyclohexylidene-(1-methylazetidin-3-yl)-[4-[[5-[3-[[3-(trifluoromethyl)phenyl]carbamoylamino]cyclopentyl]-1H-pyrazol-3-yl]amino]pyrimidin-2-yl]azanium (PubChem CID 154687248) has the molecular formula C30H37F3N9O+ and a molecular weight of 596.68 g/mol. Its IUPAC name is cyclohexylidene-(1-methylazetidin-3-yl)-[4-[[5-[3-[[3-(trifluoromethyl)phenyl]carbamoylamino]cyclopentyl]-1H-pyrazol-3-yl]amino]pyrimidin-2-yl]azanium.
| Compound Name | cyclohexylidene-(1-methylazetidin-3-yl)-[4-[[5-[3-[[3-(trifluoromethyl)phenyl]carbamoylamino]cyclopentyl]-1H-pyrazol-3-yl]amino]pyrimidin-2-yl]azanium |
|---|---|
| PubChem CID | 154687248 |
| Molecular Formula | C30H37F3N9O+ |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | cyclohexylidene-(1-methylazetidin-3-yl)-[4-[[5-[3-[[3-(trifluoromethyl)phenyl]carbamoylamino]cyclopentyl]-1H-pyrazol-3-yl]amino]pyrimidin-2-yl]azanium |
| SMILES | CN1CC([N+](=C2CCCCC2)c2nccc(Nc3cc(C4CCC(NC(=O)Nc5cccc(C(F)(F)F)c5)C4)[nH]n3)n2)C1 |
| InChI | InChI=1S/C30H36F3N9O/c1-41-17-24(18-41)42(23-8-3-2-4-9-23)28-34-13-12-26(38-28)37-27-16-25(39-40-27)19-10-11-22(14-19)36-29(43)35-21-7-5-6-20(15-21)30(31,32)33/h5-7,12-13,15-16,19,22,24H,2-4,8-11,14,17-18H2,1H3,(H3-,34,35,36,37,38,39,40,43)/p+1 |
| InChIKey | LSCMJEYZHGPDEA-UHFFFAOYSA-O |
| XLogP | 5.78 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|