C27H28F3N7O — CID 162616929
4-N-(5-cyclopentyl-1H-pyrazol-3-yl)-2-N-[4-[[3-(trifluoromethyl)anilino]methoxymethyl]phenyl]pyrimidine-2,4-diamine (PubChem CID 162616929) has the molecular formula C27H28F3N7O and a molecular weight of 523.56 g/mol. Its IUPAC name is 4-N-(5-cyclopentyl-1H-pyrazol-3-yl)-2-N-[4-[[3-(trifluoromethyl)anilino]methoxymethyl]phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(5-cyclopentyl-1H-pyrazol-3-yl)-2-N-[4-[[3-(trifluoromethyl)anilino]methoxymethyl]phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 162616929 |
| Molecular Formula | C27H28F3N7O |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | 4-N-(5-cyclopentyl-1H-pyrazol-3-yl)-2-N-[4-[[3-(trifluoromethyl)anilino]methoxymethyl]phenyl]pyrimidine-2,4-diamine |
| SMILES | FC(F)(F)c1cccc(NCOCc2ccc(Nc3nccc(Nc4cc(C5CCCC5)[nH]n4)n3)cc2)c1 |
| InChI | InChI=1S/C27H28F3N7O/c28-27(29,30)20-6-3-7-22(14-20)32-17-38-16-18-8-10-21(11-9-18)33-26-31-13-12-24(35-26)34-25-15-23(36-37-25)19-4-1-2-5-19/h3,6-15,19,32H,1-2,4-5,16-17H2,(H3,31,33,34,35,36,37) |
| InChIKey | RLESKWZMPFTMTQ-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|