C28H34F3N8O+ — CID 154687150
(Z)-[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-methyl-[[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl]methylidene]azanium (PubChem CID 154687150) has the molecular formula C28H34F3N8O+ and a molecular weight of 555.63 g/mol. Its IUPAC name is (Z)-[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-methyl-[[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl]methylidene]azanium.
| Compound Name | (Z)-[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-methyl-[[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl]methylidene]azanium |
|---|---|
| PubChem CID | 154687150 |
| Molecular Formula | C28H34F3N8O+ |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.28 |
| IUPAC Name | (Z)-[4-[(5-cyclopentyl-1H-pyrazol-3-yl)amino]pyrimidin-2-yl]-methyl-[[4-[[3-(trifluoromethyl)phenyl]carbamoylamino]cyclohexyl]methylidene]azanium |
| SMILES | C/[N+](=C/C1CCC(NC(=O)Nc2cccc(C(F)(F)F)c2)CC1)c1nccc(Nc2cc(C3CCCC3)[nH]n2)n1 |
| InChI | InChI=1S/C28H33F3N8O/c1-39(26-32-14-13-24(36-26)35-25-16-23(37-38-25)19-5-2-3-6-19)17-18-9-11-21(12-10-18)33-27(40)34-22-8-4-7-20(15-22)28(29,30)31/h4,7-8,13-19,21H,2-3,5-6,9-12H2,1H3,(H3-,32,33,34,35,36,37,38,40)/p+1/b39-17- |
| InChIKey | QGCIMJXSZDSDFU-OAZBTLTBSA-O |
| XLogP | 6.34 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|