C13H23BrN4O3Si — CID 175964598
(3R)-3-[5-bromo-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 175964598) has the molecular formula C13H23BrN4O3Si and a molecular weight of 391.34 g/mol. Its IUPAC name is (3R)-3-[5-bromo-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | (3R)-3-[5-bromo-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 175964598 |
| Molecular Formula | C13H23BrN4O3Si |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | (3R)-3-[5-bromo-2-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | CN1CC[C@@](O)(c2nc(Br)nn2COCC[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C13H23BrN4O3Si/c1-17-6-5-13(20,11(17)19)10-15-12(14)16-18(10)9-21-7-8-22(2,3)4/h20H,5-9H2,1-4H3/t13-/m1/s1 |
| InChIKey | BNNIITLKKSPWCM-CYBMUJFWSA-N |
| XLogP | 1.40 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|