C26H33N5O4Si — CID 174146806
6-[3-[5-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]phenyl]pyridine-2-carboxamide (PubChem CID 174146806) has the molecular formula C26H33N5O4Si and a molecular weight of 507.67 g/mol. Its IUPAC name is 6-[3-[5-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]phenyl]pyridine-2-carboxamide.
| Compound Name | 6-[3-[5-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]phenyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174146806 |
| Molecular Formula | C26H33N5O4Si |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 6-[3-[5-(3-hydroxy-1-methyl-2-oxopyrrolidin-3-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]phenyl]pyridine-2-carboxamide |
| SMILES | CN1CCC(O)(c2cc(-c3cccc(-c4cccc(C(N)=O)n4)c3)nn2COCC[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C26H33N5O4Si/c1-30-12-11-26(34,25(30)33)23-16-22(29-31(23)17-35-13-14-36(2,3)4)19-8-5-7-18(15-19)20-9-6-10-21(28-20)24(27)32/h5-10,15-16,34H,11-14,17H2,1-4H3,(H2,27,32) |
| InChIKey | YMZDQYHEMSPWKZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 123.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|