C15H19N3O3Si — CID 172608767
2-formyl-7-oxo-1-(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]pyridine-4-carbonitrile (PubChem CID 172608767) has the molecular formula C15H19N3O3Si and a molecular weight of 317.42 g/mol. Its IUPAC name is 2-formyl-7-oxo-1-(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]pyridine-4-carbonitrile.
| Compound Name | 2-formyl-7-oxo-1-(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 172608767 |
| Molecular Formula | C15H19N3O3Si |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-formyl-7-oxo-1-(2-trimethylsilylethoxymethyl)-6H-pyrrolo[2,3-c]pyridine-4-carbonitrile |
| SMILES | C[Si](C)(C)CCOCn1c(C=O)cc2c(C#N)c[nH]c(=O)c21 |
| InChI | InChI=1S/C15H19N3O3Si/c1-22(2,3)5-4-21-10-18-12(9-19)6-13-11(7-16)8-17-15(20)14(13)18/h6,8-9H,4-5,10H2,1-3H3,(H,17,20) |
| InChIKey | MKKBPQADAWYVQV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|