C16H18ClN3O4Si — CID 70114860
7-chloro-6-nitro-4-oxo-8-(2-trimethylsilylethoxymethyl)-1H-quinoline-3-carbonitrile (PubChem CID 70114860) has the molecular formula C16H18ClN3O4Si and a molecular weight of 379.88 g/mol. Its IUPAC name is 7-chloro-6-nitro-4-oxo-8-(2-trimethylsilylethoxymethyl)-1H-quinoline-3-carbonitrile.
| Compound Name | 7-chloro-6-nitro-4-oxo-8-(2-trimethylsilylethoxymethyl)-1H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 70114860 |
| Molecular Formula | C16H18ClN3O4Si |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 7-chloro-6-nitro-4-oxo-8-(2-trimethylsilylethoxymethyl)-1H-quinoline-3-carbonitrile |
| SMILES | C[Si](C)(C)CCOCc1c(Cl)c([N+](=O)[O-])cc2c(=O)c(C#N)c[nH]c12 |
| InChI | InChI=1S/C16H18ClN3O4Si/c1-25(2,3)5-4-24-9-12-14(17)13(20(22)23)6-11-15(12)19-8-10(7-18)16(11)21/h6,8H,4-5,9H2,1-3H3,(H,19,21) |
| InChIKey | FIJUAUIKKRLKNH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|