C23H32N2OSi — CID 10571849
2-[(4-cyclohexylpyrido[3,4-b]indol-9-yl)methoxy]ethyl-trimethylsilane (PubChem CID 10571849) has the molecular formula C23H32N2OSi and a molecular weight of 380.61 g/mol. Its IUPAC name is 2-[(4-cyclohexylpyrido[3,4-b]indol-9-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4-cyclohexylpyrido[3,4-b]indol-9-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 10571849 |
| Molecular Formula | C23H32N2OSi |
| Molecular Weight | 380.61 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | 2-[(4-cyclohexylpyrido[3,4-b]indol-9-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1c2ccccc2c2c(C3CCCCC3)cncc21 |
| InChI | InChI=1S/C23H32N2OSi/c1-27(2,3)14-13-26-17-25-21-12-8-7-11-19(21)23-20(15-24-16-22(23)25)18-9-5-4-6-10-18/h7-8,11-12,15-16,18H,4-6,9-10,13-14,17H2,1-3H3 |
| InChIKey | WUGRXMCCYQUMTM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.61 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|