C17H20N2O — CID 10730987
9-(1,1,2,2,2-pentadeuterioethoxymethyl)-4-propylpyrido[3,4-b]indole (PubChem CID 10730987) has the molecular formula C17H20N2O and a molecular weight of 273.39 g/mol. Its IUPAC name is 9-(1,1,2,2,2-pentadeuterioethoxymethyl)-4-propylpyrido[3,4-b]indole.
| Compound Name | 9-(1,1,2,2,2-pentadeuterioethoxymethyl)-4-propylpyrido[3,4-b]indole |
|---|---|
| PubChem CID | 10730987 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | 9-(1,1,2,2,2-pentadeuterioethoxymethyl)-4-propylpyrido[3,4-b]indole |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OCn1c2ccccc2c2c(CCC)cncc21 |
| InChI | InChI=1S/C17H20N2O/c1-3-7-13-10-18-11-16-17(13)14-8-5-6-9-15(14)19(16)12-20-4-2/h5-6,8-11H,3-4,7,12H2,1-2H3/i2D3,4D2 |
| InChIKey | QAMQXEUZWCOQAS-PVGOWFQYSA-N |
| XLogP | 4.14 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |