C22H27N — CID 142538939
2-methyl-3-propan-2-yl-1-[(2-propylphenyl)methyl]indole (PubChem CID 142538939) has the molecular formula C22H27N and a molecular weight of 305.47 g/mol. Its IUPAC name is 2-methyl-3-propan-2-yl-1-[(2-propylphenyl)methyl]indole.
| Compound Name | 2-methyl-3-propan-2-yl-1-[(2-propylphenyl)methyl]indole |
|---|---|
| PubChem CID | 142538939 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 2-methyl-3-propan-2-yl-1-[(2-propylphenyl)methyl]indole |
| SMILES | CCCc1ccccc1Cn1c(C)c(C(C)C)c2ccccc21 |
| InChI | InChI=1S/C22H27N/c1-5-10-18-11-6-7-12-19(18)15-23-17(4)22(16(2)3)20-13-8-9-14-21(20)23/h6-9,11-14,16H,5,10,15H2,1-4H3 |
| InChIKey | HFPNJPSXKHKMKW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|