C17H24Cl2N2O4Si — CID 171623271
ethyl 3,4-dichloro-7-methoxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxylate (PubChem CID 171623271) has the molecular formula C17H24Cl2N2O4Si and a molecular weight of 419.38 g/mol. Its IUPAC name is ethyl 3,4-dichloro-7-methoxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxylate.
| Compound Name | ethyl 3,4-dichloro-7-methoxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 171623271 |
| Molecular Formula | C17H24Cl2N2O4Si |
| Molecular Weight | 419.38 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | ethyl 3,4-dichloro-7-methoxy-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1c(Cl)c2c(Cl)cnc(OC)c2n1COCC[Si](C)(C)C |
| InChI | InChI=1S/C17H24Cl2N2O4Si/c1-6-25-17(22)15-13(19)12-11(18)9-20-16(23-2)14(12)21(15)10-24-7-8-26(3,4)5/h9H,6-8,10H2,1-5H3 |
| InChIKey | NCVUKXOENIDYDA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|