C21H24F3N3O3Si — CID 140769607
2-[[2-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methyl]pyridine-4-carboxylic acid (PubChem CID 140769607) has the molecular formula C21H24F3N3O3Si and a molecular weight of 451.52 g/mol. Its IUPAC name is 2-[[2-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methyl]pyridine-4-carboxylic acid.
| Compound Name | 2-[[2-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methyl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 140769607 |
| Molecular Formula | C21H24F3N3O3Si |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-[[2-(trifluoromethyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]methyl]pyridine-4-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1c(C(F)(F)F)cc2cc(Cc3cc(C(=O)O)ccn3)cnc21 |
| InChI | InChI=1S/C21H24F3N3O3Si/c1-31(2,3)7-6-30-13-27-18(21(22,23)24)11-16-8-14(12-26-19(16)27)9-17-10-15(20(28)29)4-5-25-17/h4-5,8,10-12H,6-7,9,13H2,1-3H3,(H,28,29) |
| InChIKey | MOQJWMFBVJJEFO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|