C25H28FN5O4Si — CID 170634931
4-fluoro-3-[[2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonyl]amino]benzoic acid (PubChem CID 170634931) has the molecular formula C25H28FN5O4Si and a molecular weight of 509.61 g/mol. Its IUPAC name is 4-fluoro-3-[[2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonyl]amino]benzoic acid.
| Compound Name | 4-fluoro-3-[[2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 170634931 |
| Molecular Formula | C25H28FN5O4Si |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 4-fluoro-3-[[2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridine-5-carbonyl]amino]benzoic acid |
| SMILES | Cn1cc(-c2cc3cc(C(=O)Nc4cc(C(=O)O)ccc4F)cnc3n2COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C25H28FN5O4Si/c1-30-14-19(13-28-30)22-11-17-9-18(12-27-23(17)31(22)15-35-7-8-36(2,3)4)24(32)29-21-10-16(25(33)34)5-6-20(21)26/h5-6,9-14H,7-8,15H2,1-4H3,(H,29,32)(H,33,34) |
| InChIKey | GQGVSZVRGCIURG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|