C25H29F2N5O2Si — CID 66599715
[2-(2,6-difluorophenyl)-4-pyridinyl]-[5-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol (PubChem CID 66599715) has the molecular formula C25H29F2N5O2Si and a molecular weight of 497.62 g/mol. Its IUPAC name is [2-(2,6-difluorophenyl)-4-pyridinyl]-[5-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol.
| Compound Name | [2-(2,6-difluorophenyl)-4-pyridinyl]-[5-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol |
|---|---|
| PubChem CID | 66599715 |
| Molecular Formula | C25H29F2N5O2Si |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | [2-(2,6-difluorophenyl)-4-pyridinyl]-[5-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]methanol |
| SMILES | Cn1cc(-c2cnc(C(O)c3ccnc(-c4c(F)cccc4F)c3)n2COCC[Si](C)(C)C)cn1 |
| InChI | InChI=1S/C25H29F2N5O2Si/c1-31-15-18(13-30-31)22-14-29-25(32(22)16-34-10-11-35(2,3)4)24(33)17-8-9-28-21(12-17)23-19(26)6-5-7-20(23)27/h5-9,12-15,24,33H,10-11,16H2,1-4H3 |
| InChIKey | NPUOLTOTUGTPJQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|