C25H30FN5OSi — CID 140850928
2-[[5-(4-ethenyl-2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140850928) has the molecular formula C25H30FN5OSi and a molecular weight of 463.63 g/mol. Its IUPAC name is 2-[[5-(4-ethenyl-2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(4-ethenyl-2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140850928 |
| Molecular Formula | C25H30FN5OSi |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 2-[[5-(4-ethenyl-2-fluoro-6-methylphenyl)-3-(1-methylpyrazol-4-yl)pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C=Cc1cc(C)c(-c2cc3c(-c4cnn(C)c4)nn(COCC[Si](C)(C)C)c3cn2)c(F)c1 |
| InChI | InChI=1S/C25H30FN5OSi/c1-7-18-10-17(2)24(21(26)11-18)22-12-20-23(14-27-22)31(16-32-8-9-33(4,5)6)29-25(20)19-13-28-30(3)15-19/h7,10-15H,1,8-9,16H2,2-6H3 |
| InChIKey | QITSRCVGLUVDPO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|