C27H34N4O4Si — CID 171635989
ethyl 2-methyl-3-[2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzoate (PubChem CID 171635989) has the molecular formula C27H34N4O4Si and a molecular weight of 506.68 g/mol. Its IUPAC name is ethyl 2-methyl-3-[2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzoate.
| Compound Name | ethyl 2-methyl-3-[2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzoate |
|---|---|
| PubChem CID | 171635989 |
| Molecular Formula | C27H34N4O4Si |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | ethyl 2-methyl-3-[2-(1-methylpyrazol-4-yl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxybenzoate |
| SMILES | CCOC(=O)c1cccc(Oc2ccnc3c2cc(-c2cnn(C)c2)n3COCC[Si](C)(C)C)c1C |
| InChI | InChI=1S/C27H34N4O4Si/c1-7-34-27(32)21-9-8-10-24(19(21)2)35-25-11-12-28-26-22(25)15-23(20-16-29-30(3)17-20)31(26)18-33-13-14-36(4,5)6/h8-12,15-17H,7,13-14,18H2,1-6H3 |
| InChIKey | PQBYNPJWXUUCLL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 80.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|