C29H37N7O3Si — CID 162426646
6-methyl-8-(3-methyl-1,2-oxazol-5-yl)-2-(1-methylpyrazol-4-yl)-9-pyrrolidin-3-yl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f][1,7]naphthyridin-7-one (PubChem CID 162426646) has the molecular formula C29H37N7O3Si and a molecular weight of 559.75 g/mol. Its IUPAC name is 6-methyl-8-(3-methyl-1,2-oxazol-5-yl)-2-(1-methylpyrazol-4-yl)-9-pyrrolidin-3-yl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f][1,7]naphthyridin-7-one.
| Compound Name | 6-methyl-8-(3-methyl-1,2-oxazol-5-yl)-2-(1-methylpyrazol-4-yl)-9-pyrrolidin-3-yl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f][1,7]naphthyridin-7-one |
|---|---|
| PubChem CID | 162426646 |
| Molecular Formula | C29H37N7O3Si |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | 6-methyl-8-(3-methyl-1,2-oxazol-5-yl)-2-(1-methylpyrazol-4-yl)-9-pyrrolidin-3-yl-3-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-f][1,7]naphthyridin-7-one |
| SMILES | Cc1cc(-c2c(C3CCNC3)c3c4cc(-c5cnn(C)c5)n(COCC[Si](C)(C)C)c4ncc3n(C)c2=O)on1 |
| InChI | InChI=1S/C29H37N7O3Si/c1-18-11-24(39-33-18)27-25(19-7-8-30-13-19)26-21-12-22(20-14-32-34(2)16-20)36(17-38-9-10-40(4,5)6)28(21)31-15-23(26)35(3)29(27)37/h11-12,14-16,19,30H,7-10,13,17H2,1-6H3 |
| InChIKey | XXAUFRFNSCWJPU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|